CAS 866607-09-2 appears in our catalog under these names: 3-(Difluoromethoxy)phenylboronic acid, 97%, (3–(Difluoromethoxy)phenyl)boronic acid, (3-(Difluoromethoxy)phenyl)boronic acid, 97%, 97%, (3-(Difluoromethoxy)phenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 50mg, 100mg, 10g.
[3-(difluoromethoxy)phenyl]boronic acid (CAS 866607-09-2) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: [3-(difluoromethoxy)phenyl]boronic acid. InChIKey: FGQKXEUNYFZVMW-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | [3-(difluoromethoxy)phenyl]boronic acid |
| InChIKey | FGQKXEUNYFZVMW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC(F)F)(O)O |
Computed by PubChem (NCBI)