cas: 2096341-72-7 — see every product listed under this CAS number, including other names
(3-Ethoxy-2,4-difluorophenyl)boronic acid, ≥95%, ≥95% (CAS 2096341-72-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHDU-1g |
| cas | 2096341-72-7 |
| size | 1g |
| availability | 27g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 885.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3-ethoxy-2,4-difluorophenyl)boronic acid (CAS 2096341-72-7) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (3-ethoxy-2,4-difluorophenyl)boronic acid. InChIKey: MDTWVBBUFJJKQJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (3-ethoxy-2,4-difluorophenyl)boronic acid |
| InChIKey | MDTWVBBUFJJKQJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OCC)F)(O)O |
Computed by PubChem (NCBI)