Products 2096333-93-4
CAS 2096333-93-4 appears in our catalog under these names: 4-Ethoxy-3,5-difluorophenylboronic acid, 4-Ethoxy-3,5-difluorophenylboronic acid, 98%, 4-Ethoxy-3,5-difluorophenylboronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
(4-ethoxy-3,5-difluorophenyl)boronic acid (CAS 2096333-93-4) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-3,5-difluorophenyl)boronic acid. InChIKey: TXTPXECXPGXRDS-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-3,5-difluorophenyl)boronic acid |
| InChIKey | TXTPXECXPGXRDS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OCC)F)(O)O |
Computed by PubChem (NCBI)