Products 870778-87-3
CAS 870778-87-3 appears in our catalog under these names: 4,5-Difluoro-2-ethoxyphenylboronic acid, 98%, 4,5–Difluoro–2–ethoxyphenylboronic acid(contains varying amounts of Anhydride), (2-Ethoxy-4,5-difluorophenyl)boronic acid 98%, (2-Ethoxy-4,5-difluorophenyl)boronic acid, 98%, 98%, (2-Ethoxy-4,5-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
(2-ethoxy-4,5-difluorophenyl)boronic acid (CAS 870778-87-3) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (2-ethoxy-4,5-difluorophenyl)boronic acid. InChIKey: DIDGIGNOIJJEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (2-ethoxy-4,5-difluorophenyl)boronic acid |
| InChIKey | DIDGIGNOIJJEGJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC)F)F)(O)O |
Computed by PubChem (NCBI)