Products 1451391-69-7
CAS 1451391-69-7 appears in our catalog under these names: 3,4-Difluoro-2-ethoxyphenylboronic acid, 95%, 3,4-Difluoro-2-ethoxyphenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(2-ethoxy-3,4-difluorophenyl)boronic acid (CAS 1451391-69-7) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (2-ethoxy-3,4-difluorophenyl)boronic acid. InChIKey: WIKOTGIBEIIHHU-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (2-ethoxy-3,4-difluorophenyl)boronic acid |
| InChIKey | WIKOTGIBEIIHHU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)F)OCC)(O)O |
Computed by PubChem (NCBI)