Products 958451-72-4
CAS 958451-72-4 appears in our catalog under these names: 4-Difluoromethoxy-3-methyl-benzeneboronic acid, 98%, (4-(Difluoromethoxy)-3-methylphenyl)boronic acid, 98%, (4-(Difluoromethoxy)-3-methylphenyl)boronic acid, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
[4-(difluoromethoxy)-3-methylphenyl]boronic acid (CAS 958451-72-4) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: [4-(difluoromethoxy)-3-methylphenyl]boronic acid. InChIKey: HNSXGLPRKOFDNV-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | [4-(difluoromethoxy)-3-methylphenyl]boronic acid |
| InChIKey | HNSXGLPRKOFDNV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)F)C)(O)O |
Computed by PubChem (NCBI)