Products 2096341-72-7
CAS 2096341-72-7 appears in our catalog under these names: 3-Ethoxy-2,4-difluorophenylboronic acid, 98%, (3-Ethoxy-2,4-difluorophenyl)boronic acid, ≥95%, ≥95%, 3-Ethoxy-2,4-difluorophenylboronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g.
(3-ethoxy-2,4-difluorophenyl)boronic acid (CAS 2096341-72-7) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (3-ethoxy-2,4-difluorophenyl)boronic acid. InChIKey: MDTWVBBUFJJKQJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (3-ethoxy-2,4-difluorophenyl)boronic acid |
| InChIKey | MDTWVBBUFJJKQJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OCC)F)(O)O |
Computed by PubChem (NCBI)