Products 2096338-65-5

CAS 2096338-65-5 is the registry number for 3,5-Difluoro-4-methoxy-2-methylphenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(3,5-difluoro-4-methoxy-2-methylphenyl)boronic acid (CAS 2096338-65-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (3,5-difluoro-4-methoxy-2-methylphenyl)boronic acid. InChIKey: INITXGASRQPIOH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BF2O3
Molecular weight201.97 g/mol
IUPAC name(3,5-difluoro-4-methoxy-2-methylphenyl)boronic acid
InChIKeyINITXGASRQPIOH-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1C)F)OC)F)(O)O

Computed by PubChem (NCBI)