Products 2096331-81-4
CAS 2096331-81-4 appears in our catalog under these names: 2,4-Difluoro-3-methoxy-5-methylphenylboronic acid, 98%, 2,4-Difluoro-3-methoxy-5-methylphenylboronic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
(2,4-difluoro-3-methoxy-5-methylphenyl)boronic acid (CAS 2096331-81-4) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (2,4-difluoro-3-methoxy-5-methylphenyl)boronic acid. InChIKey: HKTDWUVVLJFRCK-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (2,4-difluoro-3-methoxy-5-methylphenyl)boronic acid |
| InChIKey | HKTDWUVVLJFRCK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OC)F)C)(O)O |
Computed by PubChem (NCBI)