Products 900175-12-4
CAS 900175-12-4 is the registry number for 5-Ethoxy-2,4-difluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 25g.
(5-ethoxy-2,4-difluorophenyl)boronic acid (CAS 900175-12-4) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (5-ethoxy-2,4-difluorophenyl)boronic acid. InChIKey: POUSZLWTMJIPDF-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (5-ethoxy-2,4-difluorophenyl)boronic acid |
| InChIKey | POUSZLWTMJIPDF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)OCC)(O)O |
Computed by PubChem (NCBI)