Products 212386-71-5
CAS 212386-71-5 appears in our catalog under these names: 2,3-Difluoro-4-ethoxyphenylboronic acid, 98%, 2,3–Difluoro–4–ethoxyphenylboronic acid(contains varying amounts of Anhydride), 4-Ethoxy-2,3-difluorophenylboronic Acid (contains varying amounts of Anhydride), (4-Ethoxy-2,3-difluorophenyl)boronic acid 97%, (4-Ethoxy-2,3-difluorophenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg.
(4-ethoxy-2,3-difluorophenyl)boronic acid (CAS 212386-71-5) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (4-ethoxy-2,3-difluorophenyl)boronic acid. InChIKey: OBKSFBWOZSQGGC-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (4-ethoxy-2,3-difluorophenyl)boronic acid |
| InChIKey | OBKSFBWOZSQGGC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
B-(4-Ethoxy-2,3-difluorophenyl)boronic acid, (4-Ethoxy-2,3-difluorophenyl)boronic acid, 2,3-Difluoro-4-Ethoxybenzeneboronic Acid, 4-ethoxy-2,3-difluorophenylboronic acid, (4-Ethoxy-2,3-difluoro-phenyl)boronic acid, (4-Ethoxy-2,3-difluorophenyl)boronicacid, Boronic acid, (4-ethoxy-2,3-difluorophenyl)-, 4-Ethoxy-2,3-difluorobenzeneboronic Acid, 2,3-Difluoro-4-ethoxyphenylboronic acid(contains varying amounts of Anhydride), 4-Ethoxy-2,3-difluorophenylboronic Acid (contains varying amounts of Anhydride)