cas: 2375943-90-9 — see every product listed under this CAS number, including other names
(3-Formyl-2,4-dimethoxyphenyl)boronic acid (CAS 2375943-90-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627056-1G |
| cas | 2375943-90-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6329.04 Pln |
| delivery time | 3-4 weeks |
|---|
(3-formyl-2,4-dimethoxyphenyl)boronic acid (CAS 2375943-90-9) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (3-formyl-2,4-dimethoxyphenyl)boronic acid. InChIKey: XDSWOCDVIGVYCL-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (3-formyl-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | XDSWOCDVIGVYCL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)