Products 2468045-30-7
CAS 2468045-30-7 appears in our catalog under these names: 2,5-Dimethoxy-4-formylphenylboronic acid, 95%, (4-Formyl-2,5-dimethoxyphenyl)boronic acid 98%, 2,5-Dimethoxy-4-formylphenylboronic acid, 98%, 98%, 2,5-Dimethoxy-4-formylphenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100mg.
(4-formyl-2,5-dimethoxyphenyl)boronic acid (CAS 2468045-30-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,5-dimethoxyphenyl)boronic acid. InChIKey: DTUOLKLERIMYCW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,5-dimethoxyphenyl)boronic acid |
| InChIKey | DTUOLKLERIMYCW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)