CAS 2375943-90-9 appears in our catalog under these names: (3-Formyl-2,4-dimethoxyphenyl)boronic acid, 95%, (3-Formyl-2,4-dimethoxyphenyl)boronic acid, ≥95%, ≥95%, (3-Formyl-2,4-dimethoxyphenyl)boronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(3-formyl-2,4-dimethoxyphenyl)boronic acid (CAS 2375943-90-9) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (3-formyl-2,4-dimethoxyphenyl)boronic acid. InChIKey: XDSWOCDVIGVYCL-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (3-formyl-2,4-dimethoxyphenyl)boronic acid |
| InChIKey | XDSWOCDVIGVYCL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)