CAS 2001080-85-7 appears in our catalog under these names: 4-Formyl-3,5-dimethoxyphenylboronic acid, 97%, (4–Formyl–3,5–dimethoxyphenyl)boronic acid, (4-Formyl-3,5-Dimethoxyphenyl)Boronic Acid, 97%, 97%, (4-Formyl-3,5-dimethoxyphenyl)boronic acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
(4-formyl-3,5-dimethoxyphenyl)boronic acid (CAS 2001080-85-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-3,5-dimethoxyphenyl)boronic acid. InChIKey: AMCMBLFQAZPIPI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-3,5-dimethoxyphenyl)boronic acid |
| InChIKey | AMCMBLFQAZPIPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)