CAS 1256355-40-4 appears in our catalog under these names: 2-Methoxycarbonyl-4-methoxyphenylboronic Acid, 2-Methoxycarbonyl-4-methoxyphenylboronic acid, 96%, (4-Methoxy-2-(methoxycarbonyl)phenyl)boronic acid 96%, (4-Methoxy-2-(methoxycarbonyl)phenyl)boronic acid, 96%, (4-Methoxy-2-(Methoxycarbonyl)Phenyl)Boronic Acid, 96%, 96%. Offered by: TRC, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
(4-methoxy-2-methoxycarbonylphenyl)boronic acid (CAS 1256355-40-4) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-methoxy-2-methoxycarbonylphenyl)boronic acid. InChIKey: QJEMXKRTNMWVHO-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-methoxy-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | QJEMXKRTNMWVHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)