CAS 851335-10-9 is the registry number for 4-(Dihydroxyboranyl)-2-ethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-borono-2-ethoxybenzoic acid (CAS 851335-10-9) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: 4-borono-2-ethoxybenzoic acid. InChIKey: VWIFXHUGYAGNJM-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 4-borono-2-ethoxybenzoic acid |
| InChIKey | VWIFXHUGYAGNJM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)O)OCC)(O)O |
Computed by PubChem (NCBI)