CAS 1048330-11-5 appears in our catalog under these names: 3-Borono-5-methoxy-benzoic acid,1-methyl ester, 96%, (3-Methoxy-5-(methoxycarbonyl)phenyl)boronic acid 98+%, (3-Methoxy-5-(methoxycarbonyl)phenyl)boronic acid, 98+%, 98+%, (3-Methoxy-5-(methoxycarbonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g, 500mg.
(3-methoxy-5-methoxycarbonylphenyl)boronic acid (CAS 1048330-11-5) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (3-methoxy-5-methoxycarbonylphenyl)boronic acid. InChIKey: OFUYEZFEGZXILY-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (3-methoxy-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | OFUYEZFEGZXILY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)