CAS 2096331-94-9 appears in our catalog under these names: 2-Formyl-3,5-dimethoxyphenylboronic acid, 96%, (2-Formyl-3,5-dimethoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(2-formyl-3,5-dimethoxyphenyl)boronic acid (CAS 2096331-94-9) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (2-formyl-3,5-dimethoxyphenyl)boronic acid. InChIKey: CEDOKIIRVBABOG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (2-formyl-3,5-dimethoxyphenyl)boronic acid |
| InChIKey | CEDOKIIRVBABOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1C=O)OC)OC)(O)O |
Computed by PubChem (NCBI)