Products 1256355-34-6
CAS 1256355-34-6 appears in our catalog under these names: 2,6-Dimethoxy-4-formylphenylboronic acid, 98%, (4-Formyl-2,6-dimethoxyphenyl)boronic acid 98%, 2,6-Dimethoxy-4-formylphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(4-formyl-2,6-dimethoxyphenyl)boronic acid (CAS 1256355-34-6) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,6-dimethoxyphenyl)boronic acid. InChIKey: SNAHFCPYLSJIAT-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | SNAHFCPYLSJIAT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dimethoxy-4-formylphenylboronic acid, (4-formyl-2,6-dimethoxyphenyl)boronic acid, 2,6-Dimethoxy-4-formylbenzeneboronic acid, Boronic acid, B-(4-formyl-2,6-dimethoxyphenyl)-, (4-formyl-2,6-dimethoxy-phenyl)boronic Acid, 4-Borono-3,5-dimethoxybenzaldehyde, (4-formyl-2,6-dimethoxyphenyl)boronicacid