CAS 1451391-73-3 appears in our catalog under these names: 3-Borono-4-ethoxybenzoic acid, 97%, 5-Carboxy-2-ethoxyphenylboronic acid, 97%, 5-Carboxy-2-ethoxyphenylboronic acid, 97%, 97%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-borono-4-ethoxybenzoic acid (CAS 1451391-73-3) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: 3-borono-4-ethoxybenzoic acid. InChIKey: CMUVOHRXIPPHFW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 3-borono-4-ethoxybenzoic acid |
| InChIKey | CMUVOHRXIPPHFW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)OCC)(O)O |
Computed by PubChem (NCBI)