cas: 2246544-61-4 — see every product listed under this CAS number, including other names
(4-((2,6-Difluorobenzyl)oxy)phenyl)boronic acid, 95%, 95% (CAS 2246544-61-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FKZH-250mg |
| cas | 2246544-61-4 |
| size | 250mg |
| availability | 4.89g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-[(2,6-difluorophenyl)methoxy]phenyl]boronic acid (CAS 2246544-61-4) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [4-[(2,6-difluorophenyl)methoxy]phenyl]boronic acid. InChIKey: MVUGISHBPKVKES-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [4-[(2,6-difluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | MVUGISHBPKVKES-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=C(C=CC=C2F)F)(O)O |
Computed by PubChem (NCBI)