(4-(Methylsulfonyl)phenyl)methanamine hydrochloride, 98%, 98%
cas: 98593-51-2 — see every product listed under this CAS number, including other names
(4-(Methylsulfonyl)phenyl)methanamine hydrochloride, 98%, 98% (CAS 98593-51-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K0E-250mg |
| cas | 98593-51-2 |
| size | 250mg |
| availability | 40g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 386.00 Pln | |
| Chemat | 25g | 861.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-methylsulfonylphenyl)methanamine;hydrochloride (CAS 98593-51-2) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: (4-methylsulfonylphenyl)methanamine;hydrochloride. InChIKey: NRXMOYDZMKXKMJ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | (4-methylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | NRXMOYDZMKXKMJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Methanesulfonylbenzylamine hydrochloride, 4-methylsulfonylbenzylamine hydrochloride, 4-(Methylsulfonyl)benzylamine hydrochloride, Benzenemethanamine, 4-(methylsulfonyl)-, hydrochloride, BENZYLAMINE, p-(METHYLSULFONYL)-, HYDROCHLORIDE, p-(Methylsulfonyl)benzylamine hydrochloride, p-Methylsulphonylbenzylamine hydrochloride, (4-(methylsulfonyl)phenyl)methanamine hydrochloride, 4-(methylsulphonyl)benzylamine hydrochloride, (4-methanesulfonylphenyl)methanamine hydrochloride