cas: 98593-51-2 — see every product listed under this CAS number, including other names
4-(Methylsulfonyl)benzylamine hydrochloride, 95% (CAS 98593-51-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023367-1G |
| cas | 98593-51-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 560.24 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(4-methylsulfonylphenyl)methanamine;hydrochloride (CAS 98593-51-2) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: (4-methylsulfonylphenyl)methanamine;hydrochloride. InChIKey: NRXMOYDZMKXKMJ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | (4-methylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | NRXMOYDZMKXKMJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)