cas: 3047-99-2 — see every product listed under this CAS number, including other names
(4-(Trifluoromethyl)phenyl)methanamine hydrochloride (CAS 3047-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238621-100MG |
| cas | 3047-99-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 565.44 Pln |
| delivery time | 3-4 weeks |
|---|
[4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 3047-99-2) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: DDDIOEYMKVFUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | DDDIOEYMKVFUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)