cas: 3047-99-2 — see every product listed under this CAS number, including other names
(4-(Trifluoromethyl)phenyl)methanamine hydrochloride, 98+% (CAS 3047-99-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A364002-250mg |
| cas | 3047-99-2 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 317.38 Pln | |
| AmBeed | 1g | 369.46 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 3047-99-2) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: DDDIOEYMKVFUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | DDDIOEYMKVFUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)