cas: 3047-99-2 — see every product listed under this CAS number, including other names
4–(Trifluoromethyl)benzylamine Hydrochloride (CAS 3047-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB55485-100g |
| cas | 3047-99-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 9653.81 Pln | |
| GLPBio | 10g | 1930.98 Pln | |
| GLPBio | 1g | 667.25 Pln | |
| GLPBio | 25g | 3447.46 Pln | |
| GLPBio | 5g | 1280.39 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 3047-99-2) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: DDDIOEYMKVFUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | DDDIOEYMKVFUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)