cas: 3047-99-2 — see every product listed under this CAS number, including other names
(4-(Trifluoromethyl)phenyl)methanamine hydrochloride, 98%+, 98%+ (CAS 3047-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11419W-1g |
| cas | 3047-99-2 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 10g | 410.00 Pln |
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
[4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 3047-99-2) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: DDDIOEYMKVFUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | DDDIOEYMKVFUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)