cas: 3047-99-2 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)benzylamine Hydrochloride, >98.0%(HPLC)(N) (CAS 3047-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3836-1G |
| cas | 3047-99-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 172.43 Pln | |
| TCI | 5g | 560.90 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
[4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 3047-99-2) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: DDDIOEYMKVFUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | DDDIOEYMKVFUGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)