cas: 1256355-40-4 — see every product listed under this CAS number, including other names
(4-Methoxy-2-(Methoxycarbonyl)Phenyl)Boronic Acid, 96%, 96% (CAS 1256355-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O5I-100mg |
| cas | 1256355-40-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 1130.00 Pln | |
| Chemat | 1g | 2195.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(4-methoxy-2-methoxycarbonylphenyl)boronic acid (CAS 1256355-40-4) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-methoxy-2-methoxycarbonylphenyl)boronic acid. InChIKey: QJEMXKRTNMWVHO-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-methoxy-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | QJEMXKRTNMWVHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)