cas: 185950-64-5 — see every product listed under this CAS number, including other names
(5-Chloro-2-pivalamidophenyl)boronic acid, 95+% (CAS 185950-64-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A392890-25g |
| cas | 185950-64-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 45262.42 Pln | |
| AmBeed | 10g | 23089.36 Pln | |
| AmBeed | 5g | 13610.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[5-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 185950-64-5) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [5-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: GIAJZMJDKJWGNY-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [5-chloro-2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | GIAJZMJDKJWGNY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)