(6-(Benzyloxy)-2,3-difluorophenyl)boronic acid, 97%
cas: 1451393-19-3 — see every product listed under this CAS number, including other names
(6-(Benzyloxy)-2,3-difluorophenyl)boronic acid, 97% (CAS 1451393-19-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A166070-250mg |
| cas | 1451393-19-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 1176.94 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 253.27 Pln | |
| BLDpharm | 5g | 708.66 Pln | |
| BLDpharm | 10g | 1264.02 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 492.55 Pln | |
| Fluorochem | 5g | 1617.16 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2,3-difluoro-6-phenylmethoxyphenyl)boronic acid (CAS 1451393-19-3) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,3-difluoro-6-phenylmethoxyphenyl)boronic acid. InChIKey: SLVNSQQTZBWDTP-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,3-difluoro-6-phenylmethoxyphenyl)boronic acid |
| InChIKey | SLVNSQQTZBWDTP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3-Difluoro-6-benzyloxyphenylboronic acid, (6-(Benzyloxy)-2,3-difluorophenyl)boronic acid, 6-(benzyloxy)-2,3-difluorophenylboronic acid, (2,3-difluoro-6-phenylmethoxyphenyl)boronic acid, (6-Benzyloxy-2,3-difluoro-phenyl)boronic acid, Boronic acid, B-[2,3-difluoro-6-(phenylmethoxy)phenyl]-, 6-Benzyloxy-2,3-difluorophenylboronic acid, (6-(Benzyloxy)-2,3-difluorophenyl)boronicacid