CAS 1810074-70-4 appears in our catalog under these names: (R)–7–Bromochroman–4–amine hydrochloride, (R)-7-Bromochroman-4-amine hydrochloride, 95%, (R)-7-Bromochroman-4-amine hydrochloride, 98%, (R)-7-Bromochroman-4-amine hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
(4R)-7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1810074-70-4) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: (4R)-7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: BVJCAWWHYBICLV-DDWIOCJRSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | (4R)-7-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | BVJCAWWHYBICLV-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=CC(=C2)Br.Cl |
Computed by PubChem (NCBI)