cas: 70918-54-6 — see every product listed under this CAS number, including other names
(S)-1,4-Benzodioxane-2-carboxylic acid 97% (CAS 70918-54-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A771804-250mg |
| cas | 70918-54-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A771804 |
(3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 70918-54-6) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-QMMMGPOBSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | HMBHAQMOBKLWRX-QMMMGPOBSA-N |
| SMILES | C1[C@H](OC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)