cas: 122745-10-2 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(naphthalen-1-yl)propanoic acid hydrochloride, 97% (CAS 122745-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229977-250MG |
| cas | 122745-10-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1247.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride (CAS 122745-10-2) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride. InChIKey: BKQQPCDQZZTLSE-YDALLXLXSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride |
| InChIKey | BKQQPCDQZZTLSE-YDALLXLXSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)