cas: 122745-10-2 — see every product listed under this CAS number, including other names
3-(1-Naphthyl)-L-alanine Hydrochloride, >97.0%(HPLC)(T) (CAS 122745-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0773-1G |
| cas | 122745-10-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 428.13 Pln | |
| TCI | 5g | 1436.17 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC)(T) |
(2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride (CAS 122745-10-2) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride. InChIKey: BKQQPCDQZZTLSE-YDALLXLXSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2S)-2-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride |
| InChIKey | BKQQPCDQZZTLSE-YDALLXLXSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)