cas: 122745-12-4 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(naphthalen-2-yl)propanoic acid hydrochloride, 95% (CAS 122745-12-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A640223-250mg |
| cas | 122745-12-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1358.98 Pln | |
| AmBeed | 5g | 9698.29 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride (CAS 122745-12-4) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride. InChIKey: QXEYSNIVQNSZGX-YDALLXLXSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride |
| InChIKey | QXEYSNIVQNSZGX-YDALLXLXSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)