cas: 122745-12-4 — see every product listed under this CAS number, including other names
3-(2-Naphthyl)-L-alanine Hydrochloride, >98.0%(HPLC)(T) (CAS 122745-12-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0683-1G |
| cas | 122745-12-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 619.90 Pln | |
| TCI | 5g | 2026.24 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
(2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride (CAS 122745-12-4) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride. InChIKey: QXEYSNIVQNSZGX-YDALLXLXSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (2S)-2-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride |
| InChIKey | QXEYSNIVQNSZGX-YDALLXLXSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)