cas: 23789-34-6 — see every product listed under this CAS number, including other names
(Z,Z)-a-Furil Dioxime (CAS 23789-34-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117UKD-250mg |
| cas | 23789-34-6 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1672.40 Pln |
| delivery time | 3 weeks |
|---|
(NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine (CAS 23789-34-6) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: (NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine. InChIKey: RBOZTFPIXJBLPK-WGDLNXRISA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | (NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine |
| InChIKey | RBOZTFPIXJBLPK-WGDLNXRISA-N |
| SMILES | C1=COC(=C1)/C(=N\O)/C(=N/O)/C2=CC=CO2 |
Computed by PubChem (NCBI)