Products 929971-79-9
CAS 929971-79-9 is the registry number for 1-(3-Methoxyphenyl)imidazolidine-2,4,5-trione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(3-methoxyphenyl)imidazolidine-2,4,5-trione (CAS 929971-79-9) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 1-(3-methoxyphenyl)imidazolidine-2,4,5-trione. InChIKey: NIQKUAZKRJCIOQ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)imidazolidine-2,4,5-trione |
| InChIKey | NIQKUAZKRJCIOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C(=O)C(=O)NC2=O |
Computed by PubChem (NCBI)