Products 1105192-61-7

CAS 1105192-61-7 is the registry number for [3-(2-Furyl)-6-oxopyridazin-1(6(h))-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetic acid (CAS 1105192-61-7) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetic acid. InChIKey: BOVLYDIHHNLNCR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O4
Molecular weight220.18 g/mol
IUPAC name2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]acetic acid
InChIKeyBOVLYDIHHNLNCR-UHFFFAOYSA-N
SMILESC1=COC(=C1)C2=NN(C(=O)C=C2)CC(=O)O

Computed by PubChem (NCBI)