[1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-diamine, 95%
cas: 53693-67-7 — see every product listed under this CAS number, including other names
[1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-diamine, 95% (CAS 53693-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0R2-100mg |
| cas | 53693-67-7 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 1010.00 Pln | |
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 367.60 Pln | |
| Fluorochem | 5g | 1601.54 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[4-[4-(4-aminophenyl)phenyl]phenyl]aniline (CAS 53693-67-7) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-[4-[4-(4-aminophenyl)phenyl]phenyl]aniline. InChIKey: JZIAOTUERDUSJC-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenyl)phenyl]phenyl]aniline |
| InChIKey | JZIAOTUERDUSJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)