cas: 1210-05-5 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,2'-dicarbaldehyde, 97.0%, 97.0% (CAS 1210-05-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O82-100mg |
| cas | 1210-05-5 |
| size | 100mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln |
| purity | 97.0% |
|---|---|
| delivery time | 3 weeks |
2-(2-formylphenyl)benzaldehyde (CAS 1210-05-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2-formylphenyl)benzaldehyde. InChIKey: HJFGULDHUDIPDA-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(2-formylphenyl)benzaldehyde |
| InChIKey | HJFGULDHUDIPDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)