cas: 1210-05-5 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-2,2'-dicarbaldehyde (CAS 1210-05-5) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F732136-10MG |
| cas | 1210-05-5 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 513.38 Pln | |
| Fluorochem | 25mg | 997.58 Pln | |
| Fluorochem | 100mg | 2512.67 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2-formylphenyl)benzaldehyde (CAS 1210-05-5) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(2-formylphenyl)benzaldehyde. InChIKey: HJFGULDHUDIPDA-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(2-formylphenyl)benzaldehyde |
| InChIKey | HJFGULDHUDIPDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)