1,2-Dibromo-3-nitrobenzene 96%
cas: 26429-41-4 — see every product listed under this CAS number, including other names
1,2-Dibromo-3-nitrobenzene 96% (CAS 26429-41-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A606169-100mg |
| cas | 26429-41-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 10g | 3212.81 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A606169 |
1,2-dibromo-3-nitrobenzene (CAS 26429-41-4) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,2-dibromo-3-nitrobenzene. InChIKey: LPOQWSWPRAGSBK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,2-dibromo-3-nitrobenzene |
| InChIKey | LPOQWSWPRAGSBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)