cas: 26429-41-4 — see every product listed under this CAS number, including other names
1,2-Dibromo-3-nitrobenzene, 97% (CAS 26429-41-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217190-250MG |
| cas | 26429-41-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 529.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,2-dibromo-3-nitrobenzene (CAS 26429-41-4) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,2-dibromo-3-nitrobenzene. InChIKey: LPOQWSWPRAGSBK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,2-dibromo-3-nitrobenzene |
| InChIKey | LPOQWSWPRAGSBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)