1,2-Dibromo-3-nitrobenzene, 96%
cas: 26429-41-4 — see every product listed under this CAS number, including other names
1,2-Dibromo-3-nitrobenzene, 96% (CAS 26429-41-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A606169-250mg |
| cas | 26429-41-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1972.38 Pln | |
| Ambeed | 10g | 3246.19 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1590.80 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 425.43 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| BLDpharm | 5g | 2124.83 Pln | |
| BLDpharm | 10g | 3491.02 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
1,2-dibromo-3-nitrobenzene (CAS 26429-41-4) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,2-dibromo-3-nitrobenzene. InChIKey: LPOQWSWPRAGSBK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,2-dibromo-3-nitrobenzene |
| InChIKey | LPOQWSWPRAGSBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)