1,3-Dioxoisoindolin-2-yl 3-phenylpropanoate, 97%
cas: 84379-71-5 — see every product listed under this CAS number, including other names
1,3-Dioxoisoindolin-2-yl 3-phenylpropanoate, 97% (CAS 84379-71-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1496201-250mg |
| cas | 84379-71-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1032.31 Pln | |
| Ambeed | 10g | 1616.38 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 364.34 Pln | |
| BLDpharm | 5g | 1108.52 Pln | |
| BLDpharm | 10g | 2030.42 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 525.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1,3-dioxoisoindol-2-yl) 3-phenylpropanoate (CAS 84379-71-5) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 3-phenylpropanoate. InChIKey: JPQIUWUEOYWICT-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 3-phenylpropanoate |
| InChIKey | JPQIUWUEOYWICT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
1,3-Dioxoisoindolin-2-yl 3-phenylpropanoate, (1,3-dioxoisoindol-2-yl) 3-phenylpropanoate, 1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl benzenepropanoate, Benzenepropanoic acid phthalimidyl ester, (1,3-dioxoisoindolin-2-yl) 3-phenylpropanoate, Benzenepropanoic acid, 1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl ester
