Products 84379-71-5
CAS 84379-71-5 appears in our catalog under these names: 1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpropanoate, 1,3-Dioxoisoindolin-2-yl 3-phenylpropanoate, 97%, 1,3-Dioxoisoindolin-2-yl 3-phenylpropanoate, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g.
(1,3-dioxoisoindol-2-yl) 3-phenylpropanoate (CAS 84379-71-5) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 3-phenylpropanoate. InChIKey: JPQIUWUEOYWICT-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 3-phenylpropanoate |
| InChIKey | JPQIUWUEOYWICT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
1,3-Dioxoisoindolin-2-yl 3-phenylpropanoate, (1,3-dioxoisoindol-2-yl) 3-phenylpropanoate, 1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl benzenepropanoate, Benzenepropanoic acid phthalimidyl ester, (1,3-dioxoisoindolin-2-yl) 3-phenylpropanoate, Benzenepropanoic acid, 1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl ester