cas: 4442-53-9 — see every product listed under this CAS number, including other names
1,4-Benzodioxane-5-carboxylic Acid, >98.0%(GC)(T) (CAS 4442-53-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3864-5G |
| cas | 4442-53-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 197.02 Pln | |
| TCI | 25g | 580.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 4442-53-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: VCLSWKVAHAJSFL-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | VCLSWKVAHAJSFL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)